C20H18ClF4N5O — CID 122520247
3-[[5-chloro-1-(4-fluorobutyl)pyrrolo[2,3-c]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-2-one (PubChem CID 122520247) has the molecular formula C20H18ClF4N5O and a molecular weight of 455.84 g/mol. Its IUPAC name is 3-[[5-chloro-1-(4-fluorobutyl)pyrrolo[2,3-c]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-2-one.
| Compound Name | 3-[[5-chloro-1-(4-fluorobutyl)pyrrolo[2,3-c]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 122520247 |
| Molecular Formula | C20H18ClF4N5O |
| Molecular Weight | 455.84 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 3-[[5-chloro-1-(4-fluorobutyl)pyrrolo[2,3-c]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-2-one |
| SMILES | O=c1n(Cc2cc3cc(Cl)ncc3n2CCCCF)c2cnccc2n1CC(F)(F)F |
| InChI | InChI=1S/C20H18ClF4N5O/c21-18-8-13-7-14(28(6-2-1-4-22)16(13)10-27-18)11-29-17-9-26-5-3-15(17)30(19(29)31)12-20(23,24)25/h3,5,7-10H,1-2,4,6,11-12H2 |
| InChIKey | MZLTUUBIOOFPOA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 57.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.84 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|