C23H25ClN4O — CID 122520250
1-[[5-chloro-1-(3-methylbutyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]-3-cyclopropylbenzimidazol-2-one (PubChem CID 122520250) has the molecular formula C23H25ClN4O and a molecular weight of 408.93 g/mol. Its IUPAC name is 1-[[5-chloro-1-(3-methylbutyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]-3-cyclopropylbenzimidazol-2-one.
| Compound Name | 1-[[5-chloro-1-(3-methylbutyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]-3-cyclopropylbenzimidazol-2-one |
|---|---|
| PubChem CID | 122520250 |
| Molecular Formula | C23H25ClN4O |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 1-[[5-chloro-1-(3-methylbutyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]-3-cyclopropylbenzimidazol-2-one |
| SMILES | CC(C)CCn1c(Cn2c(=O)n(C3CC3)c3ccccc32)cc2nc(Cl)ccc21 |
| InChI | InChI=1S/C23H25ClN4O/c1-15(2)11-12-26-17(13-18-19(26)9-10-22(24)25-18)14-27-20-5-3-4-6-21(20)28(23(27)29)16-7-8-16/h3-6,9-10,13,15-16H,7-8,11-12,14H2,1-2H3 |
| InChIKey | ZWLSTWOTITWUBF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 44.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|