C22H20ClF3N4O — CID 122520255
1-[[5-chloro-1-(4,4,4-trifluorobutyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]-3-cyclopropylbenzimidazol-2-one (PubChem CID 122520255) has the molecular formula C22H20ClF3N4O and a molecular weight of 448.88 g/mol. Its IUPAC name is 1-[[5-chloro-1-(4,4,4-trifluorobutyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]-3-cyclopropylbenzimidazol-2-one.
| Compound Name | 1-[[5-chloro-1-(4,4,4-trifluorobutyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]-3-cyclopropylbenzimidazol-2-one |
|---|---|
| PubChem CID | 122520255 |
| Molecular Formula | C22H20ClF3N4O |
| Molecular Weight | 448.88 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 1-[[5-chloro-1-(4,4,4-trifluorobutyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]-3-cyclopropylbenzimidazol-2-one |
| SMILES | O=c1n(Cc2cc3nc(Cl)ccc3n2CCCC(F)(F)F)c2ccccc2n1C1CC1 |
| InChI | InChI=1S/C22H20ClF3N4O/c23-20-9-8-17-16(27-20)12-15(28(17)11-3-10-22(24,25)26)13-29-18-4-1-2-5-19(18)30(21(29)31)14-6-7-14/h1-2,4-5,8-9,12,14H,3,6-7,10-11,13H2 |
| InChIKey | SUXUQLWQFMGVAO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 44.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.88 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|