C21H19ClF4N4O — CID 122520259
1-[[5-chloro-1-(4-fluorobutyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]-3-(2,2,2-trifluoroethyl)benzimidazol-2-one (PubChem CID 122520259) has the molecular formula C21H19ClF4N4O and a molecular weight of 454.86 g/mol. Its IUPAC name is 1-[[5-chloro-1-(4-fluorobutyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]-3-(2,2,2-trifluoroethyl)benzimidazol-2-one.
| Compound Name | 1-[[5-chloro-1-(4-fluorobutyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]-3-(2,2,2-trifluoroethyl)benzimidazol-2-one |
|---|---|
| PubChem CID | 122520259 |
| Molecular Formula | C21H19ClF4N4O |
| Molecular Weight | 454.86 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 1-[[5-chloro-1-(4-fluorobutyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]-3-(2,2,2-trifluoroethyl)benzimidazol-2-one |
| SMILES | O=c1n(Cc2cc3nc(Cl)ccc3n2CCCCF)c2ccccc2n1CC(F)(F)F |
| InChI | InChI=1S/C21H19ClF4N4O/c22-19-8-7-16-15(27-19)11-14(28(16)10-4-3-9-23)12-29-17-5-1-2-6-18(17)30(20(29)31)13-21(24,25)26/h1-2,5-8,11H,3-4,9-10,12-13H2 |
| InChIKey | IMSXWDOPDXUFEY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 44.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.86 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|