C21H17ClF3N5O — CID 122520265
4-[5-chloro-2-[[2-oxo-3-(2,2,2-trifluoroethyl)benzimidazol-1-yl]methyl]pyrrolo[3,2-b]pyridin-1-yl]butanenitrile (PubChem CID 122520265) has the molecular formula C21H17ClF3N5O and a molecular weight of 447.85 g/mol. Its IUPAC name is 4-[5-chloro-2-[[2-oxo-3-(2,2,2-trifluoroethyl)benzimidazol-1-yl]methyl]pyrrolo[3,2-b]pyridin-1-yl]butanenitrile.
| Compound Name | 4-[5-chloro-2-[[2-oxo-3-(2,2,2-trifluoroethyl)benzimidazol-1-yl]methyl]pyrrolo[3,2-b]pyridin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 122520265 |
| Molecular Formula | C21H17ClF3N5O |
| Molecular Weight | 447.85 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 4-[5-chloro-2-[[2-oxo-3-(2,2,2-trifluoroethyl)benzimidazol-1-yl]methyl]pyrrolo[3,2-b]pyridin-1-yl]butanenitrile |
| SMILES | N#CCCCn1c(Cn2c(=O)n(CC(F)(F)F)c3ccccc32)cc2nc(Cl)ccc21 |
| InChI | InChI=1S/C21H17ClF3N5O/c22-19-8-7-16-15(27-19)11-14(28(16)10-4-3-9-26)12-29-17-5-1-2-6-18(17)30(20(29)31)13-21(23,24)25/h1-2,5-8,11H,3-4,10,12-13H2 |
| InChIKey | DVVXUVUMODCMMM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.85 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|