C18H13F2N5O — CID 122520400
2-(4-fluoro-2-methylphenyl)-6-[(6-fluoro-2-pyridinyl)oxymethyl]imidazo[1,2-b][1,2,4]triazine (PubChem CID 122520400) has the molecular formula C18H13F2N5O and a molecular weight of 353.33 g/mol. Its IUPAC name is 2-(4-fluoro-2-methylphenyl)-6-[(6-fluoro-2-pyridinyl)oxymethyl]imidazo[1,2-b][1,2,4]triazine.
| Compound Name | 2-(4-fluoro-2-methylphenyl)-6-[(6-fluoro-2-pyridinyl)oxymethyl]imidazo[1,2-b][1,2,4]triazine |
|---|---|
| PubChem CID | 122520400 |
| Molecular Formula | C18H13F2N5O |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 2-(4-fluoro-2-methylphenyl)-6-[(6-fluoro-2-pyridinyl)oxymethyl]imidazo[1,2-b][1,2,4]triazine |
| SMILES | Cc1cc(F)ccc1-c1cnc2nc(COc3cccc(F)n3)cn2n1 |
| InChI | InChI=1S/C18H13F2N5O/c1-11-7-12(19)5-6-14(11)15-8-21-18-22-13(9-25(18)24-15)10-26-17-4-2-3-16(20)23-17/h2-9H,10H2,1H3 |
| InChIKey | PGFWKSABRWGQIM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 65.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|