C31H30F2N4O5 — CID 122520438
tert-butyl 4-[4-[(3aR,6aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole-5-carbonyl]anilino]-2-(2,6-difluorophenyl)-5-oxo-7H-pyrrolo[3,4-b]pyridine-6-carboxylate (PubChem CID 122520438) has the molecular formula C31H30F2N4O5 and a molecular weight of 576.60 g/mol. Its IUPAC name is tert-butyl 4-[4-[(3aR,6aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole-5-carbonyl]anilino]-2-(2,6-difluorophenyl)-5-oxo-7H-pyrrolo[3,4-b]pyridine-6-carboxylate.
| Compound Name | tert-butyl 4-[4-[(3aR,6aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole-5-carbonyl]anilino]-2-(2,6-difluorophenyl)-5-oxo-7H-pyrrolo[3,4-b]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 122520438 |
| Molecular Formula | C31H30F2N4O5 |
| Molecular Weight | 576.60 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | tert-butyl 4-[4-[(3aR,6aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole-5-carbonyl]anilino]-2-(2,6-difluorophenyl)-5-oxo-7H-pyrrolo[3,4-b]pyridine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2nc(-c3c(F)cccc3F)cc(Nc3ccc(C(=O)N4C[C@H]5COC[C@H]5C4)cc3)c2C1=O |
| InChI | InChI=1S/C31H30F2N4O5/c1-31(2,3)42-30(40)37-14-25-27(29(37)39)24(11-23(35-25)26-21(32)5-4-6-22(26)33)34-20-9-7-17(8-10-20)28(38)36-12-18-15-41-16-19(18)13-36/h4-11,18-19H,12-16H2,1-3H3,(H,34,35)/t18-,19+ |
| InChIKey | GCVRDLDQNUOBSA-KDURUIRLSA-N |
| XLogP | 5.38 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.60 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |