C14H22N2O3 — CID 122521310
2-[(3E,5E)-6-methoxyhepta-1,3,5-trien-3-yl]oxy-1-piperazin-1-ylethanone (PubChem CID 122521310) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-[(3E,5E)-6-methoxyhepta-1,3,5-trien-3-yl]oxy-1-piperazin-1-ylethanone.
| Compound Name | 2-[(3E,5E)-6-methoxyhepta-1,3,5-trien-3-yl]oxy-1-piperazin-1-ylethanone |
|---|---|
| PubChem CID | 122521310 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2-[(3E,5E)-6-methoxyhepta-1,3,5-trien-3-yl]oxy-1-piperazin-1-ylethanone |
| SMILES | C=C/C(=C\C=C(/C)OC)OCC(=O)N1CCNCC1 |
| InChI | InChI=1S/C14H22N2O3/c1-4-13(6-5-12(2)18-3)19-11-14(17)16-9-7-15-8-10-16/h4-6,15H,1,7-11H2,2-3H3/b12-5+,13-6+ |
| InChIKey | ZJVWPRYACRMIMK-BYDSPXIWSA-N |
| XLogP | 1.05 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|