About (2E,4E)-2-chloro-5-methoxyhexa-2,4-diene
(2E,4E)-2-chloro-5-methoxyhexa-2,4-diene (PubChem CID 122521311) has the molecular formula C7H11ClO
and a molecular weight of 146.62 g/mol. Its IUPAC name is (2E,4E)-2-chloro-5-methoxyhexa-2,4-diene.
Molecular Properties
| Compound Name | (2E,4E)-2-chloro-5-methoxyhexa-2,4-diene |
| PubChem CID | 122521311 |
| Molecular Formula | C7H11ClO |
| Molecular Weight | 146.62 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | (2E,4E)-2-chloro-5-methoxyhexa-2,4-diene |
| SMILES | CO/C(C)=C/C=C(\C)Cl |
| InChI | InChI=1S/C7H11ClO/c1-6(8)4-5-7(2)9-3/h4-5H,1-3H3/b6-4+,7-5+ |
| InChIKey | PTVFZTZQQADUQW-YDFGWWAZSA-N |
| XLogP | 2.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.62 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-2-chloro-5-methoxyhexa-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-2-chloro-5-methoxyhexa-2,4-diene?
The IUPAC name of (2E,4E)-2-chloro-5-methoxyhexa-2,4-diene (CID 122521311) is (2E,4E)-2-chloro-5-methoxyhexa-2,4-diene.
What is the SMILES notation for (2E,4E)-2-chloro-5-methoxyhexa-2,4-diene?
The canonical SMILES for (2E,4E)-2-chloro-5-methoxyhexa-2,4-diene is CO/C(C)=C/C=C(\C)Cl.
What is the InChIKey of (2E,4E)-2-chloro-5-methoxyhexa-2,4-diene?
The InChIKey is PTVFZTZQQADUQW-YDFGWWAZSA-N. The full InChI is InChI=1S/C7H11ClO/c1-6(8)4-5-7(2)9-3/h4-5H,1-3H3/b6-4+,7-5+.
What are the key properties of (2E,4E)-2-chloro-5-methoxyhexa-2,4-diene?
(2E,4E)-2-chloro-5-methoxyhexa-2,4-diene has a molecular weight of 146.62 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-2-chloro-5-methoxyhexa-2,4-diene is sourced from PubChem (CID 122521311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).