C12H19FN2 — CID 122521314
1-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienyl]-4-methylpiperazine (PubChem CID 122521314) has the molecular formula C12H19FN2 and a molecular weight of 210.30 g/mol. Its IUPAC name is 1-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienyl]-4-methylpiperazine.
| Compound Name | 1-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 122521314 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 1-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienyl]-4-methylpiperazine |
| SMILES | C/C=C\C(F)=C/C=C/N1CCN(C)CC1 |
| InChI | InChI=1S/C12H19FN2/c1-3-5-12(13)6-4-7-15-10-8-14(2)9-11-15/h3-7H,8-11H2,1-2H3/b5-3-,7-4+,12-6+ |
| InChIKey | PHCUXTSVPGJQQE-SCEFCVLBSA-N |
| XLogP | 2.18 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|