About 9-methyl-1-azaspiro[4.4]nona-6,8-dien-2-one
9-methyl-1-azaspiro[4.4]nona-6,8-dien-2-one (PubChem CID 122521956) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 9-methyl-1-azaspiro[4.4]nona-6,8-dien-2-one.
Molecular Properties
| Compound Name | 9-methyl-1-azaspiro[4.4]nona-6,8-dien-2-one |
| PubChem CID | 122521956 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 9-methyl-1-azaspiro[4.4]nona-6,8-dien-2-one |
| SMILES | CC1=CC=CC12CCC(=O)N2 |
| InChI | InChI=1S/C9H11NO/c1-7-3-2-5-9(7)6-4-8(11)10-9/h2-3,5H,4,6H2,1H3,(H,10,11) |
| InChIKey | JULDNNKDEBCVTC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-methyl-1-azaspiro[4.4]nona-6,8-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-1-azaspiro[4.4]nona-6,8-dien-2-one?
The IUPAC name of 9-methyl-1-azaspiro[4.4]nona-6,8-dien-2-one (CID 122521956) is 9-methyl-1-azaspiro[4.4]nona-6,8-dien-2-one.
What is the SMILES notation for 9-methyl-1-azaspiro[4.4]nona-6,8-dien-2-one?
The canonical SMILES for 9-methyl-1-azaspiro[4.4]nona-6,8-dien-2-one is CC1=CC=CC12CCC(=O)N2.
What is the InChIKey of 9-methyl-1-azaspiro[4.4]nona-6,8-dien-2-one?
The InChIKey is JULDNNKDEBCVTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-7-3-2-5-9(7)6-4-8(11)10-9/h2-3,5H,4,6H2,1H3,(H,10,11).
What are the key properties of 9-methyl-1-azaspiro[4.4]nona-6,8-dien-2-one?
9-methyl-1-azaspiro[4.4]nona-6,8-dien-2-one has a molecular weight of 149.19 g/mol, XLogP of 1.15, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-1-azaspiro[4.4]nona-6,8-dien-2-one is sourced from PubChem (CID 122521956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).