C23H22F6N2O4 — CID 122521985
2-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-pyridinyl]methyl]-6-methoxy-5-morpholin-4-yl-2,3-dihydroinden-1-one (PubChem CID 122521985) has the molecular formula C23H22F6N2O4 and a molecular weight of 504.43 g/mol. Its IUPAC name is 2-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-pyridinyl]methyl]-6-methoxy-5-morpholin-4-yl-2,3-dihydroinden-1-one.
| Compound Name | 2-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-pyridinyl]methyl]-6-methoxy-5-morpholin-4-yl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 122521985 |
| Molecular Formula | C23H22F6N2O4 |
| Molecular Weight | 504.43 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 2-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-pyridinyl]methyl]-6-methoxy-5-morpholin-4-yl-2,3-dihydroinden-1-one |
| SMILES | COc1cc2c(cc1N1CCOCC1)CC(Cc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cn1)C2=O |
| InChI | InChI=1S/C23H22F6N2O4/c1-34-19-11-17-13(10-18(19)31-4-6-35-7-5-31)8-14(20(17)32)9-16-3-2-15(12-30-16)21(33,22(24,25)26)23(27,28)29/h2-3,10-12,14,33H,4-9H2,1H3 |
| InChIKey | WZBQEWFFJDQJGX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |