About N-(3-hydroxypropyl)-1,3-thiazolidine-2-carboxamide
N-(3-hydroxypropyl)-1,3-thiazolidine-2-carboxamide (PubChem CID 122522048) has the molecular formula C7H14N2O2S
and a molecular weight of 190.27 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-1,3-thiazolidine-2-carboxamide.
Molecular Properties
| Compound Name | N-(3-hydroxypropyl)-1,3-thiazolidine-2-carboxamide |
| PubChem CID | 122522048 |
| Molecular Formula | C7H14N2O2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | N-(3-hydroxypropyl)-1,3-thiazolidine-2-carboxamide |
| SMILES | O=C(NCCCO)C1NCCS1 |
| InChI | InChI=1S/C7H14N2O2S/c10-4-1-2-8-6(11)7-9-3-5-12-7/h7,9-10H,1-5H2,(H,8,11) |
| InChIKey | LZVJEVNFTYKPEM-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-hydroxypropyl)-1,3-thiazolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-hydroxypropyl)-1,3-thiazolidine-2-carboxamide?
The IUPAC name of N-(3-hydroxypropyl)-1,3-thiazolidine-2-carboxamide (CID 122522048) is N-(3-hydroxypropyl)-1,3-thiazolidine-2-carboxamide.
What is the SMILES notation for N-(3-hydroxypropyl)-1,3-thiazolidine-2-carboxamide?
The canonical SMILES for N-(3-hydroxypropyl)-1,3-thiazolidine-2-carboxamide is O=C(NCCCO)C1NCCS1.
What is the InChIKey of N-(3-hydroxypropyl)-1,3-thiazolidine-2-carboxamide?
The InChIKey is LZVJEVNFTYKPEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2S/c10-4-1-2-8-6(11)7-9-3-5-12-7/h7,9-10H,1-5H2,(H,8,11).
What are the key properties of N-(3-hydroxypropyl)-1,3-thiazolidine-2-carboxamide?
N-(3-hydroxypropyl)-1,3-thiazolidine-2-carboxamide has a molecular weight of 190.27 g/mol, XLogP of -0.85, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-hydroxypropyl)-1,3-thiazolidine-2-carboxamide is sourced from PubChem (CID 122522048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).