C16H16BrN3O3 — CID 122522189
ethyl 1-(3-bromophenyl)-4-(cyclopropanecarbonylamino)pyrazole-3-carboxylate (PubChem CID 122522189) has the molecular formula C16H16BrN3O3 and a molecular weight of 378.23 g/mol. Its IUPAC name is ethyl 1-(3-bromophenyl)-4-(cyclopropanecarbonylamino)pyrazole-3-carboxylate.
| Compound Name | ethyl 1-(3-bromophenyl)-4-(cyclopropanecarbonylamino)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 122522189 |
| Molecular Formula | C16H16BrN3O3 |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | ethyl 1-(3-bromophenyl)-4-(cyclopropanecarbonylamino)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2cccc(Br)c2)cc1NC(=O)C1CC1 |
| InChI | InChI=1S/C16H16BrN3O3/c1-2-23-16(22)14-13(18-15(21)10-6-7-10)9-20(19-14)12-5-3-4-11(17)8-12/h3-5,8-10H,2,6-7H2,1H3,(H,18,21) |
| InChIKey | VOCQDHMLBIQWSF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |