C29H30N3O4S+ — CID 122522306
methyl 4-[(E,3E)-3-(3-methyl-1,3-benzothiazol-2-ylidene)-1-(1-methyl-6-nitroquinolin-1-ium-2-yl)prop-1-en-2-yl]cyclohexane-1-carboxylate (PubChem CID 122522306) has the molecular formula C29H30N3O4S+ and a molecular weight of 516.64 g/mol. Its IUPAC name is methyl 4-[(E,3E)-3-(3-methyl-1,3-benzothiazol-2-ylidene)-1-(1-methyl-6-nitroquinolin-1-ium-2-yl)prop-1-en-2-yl]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[(E,3E)-3-(3-methyl-1,3-benzothiazol-2-ylidene)-1-(1-methyl-6-nitroquinolin-1-ium-2-yl)prop-1-en-2-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 122522306 |
| Molecular Formula | C29H30N3O4S+ |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | methyl 4-[(E,3E)-3-(3-methyl-1,3-benzothiazol-2-ylidene)-1-(1-methyl-6-nitroquinolin-1-ium-2-yl)prop-1-en-2-yl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(C(=C\c2ccc3cc([N+](=O)[O-])ccc3[n+]2C)/C=C2/Sc3ccccc3N2C)CC1 |
| InChI | InChI=1S/C29H30N3O4S/c1-30-23(13-12-21-16-24(32(34)35)14-15-25(21)30)17-22(19-8-10-20(11-9-19)29(33)36-3)18-28-31(2)26-6-4-5-7-27(26)37-28/h4-7,12-20H,8-11H2,1-3H3/q+1 |
| InChIKey | ZQGOZWDEXDDQJK-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 76.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|