About N-ethyl-1,2-dihydropyrazine-5-carboxamide
N-ethyl-1,2-dihydropyrazine-5-carboxamide (PubChem CID 122522531) has the molecular formula C7H11N3O
and a molecular weight of 153.19 g/mol. Its IUPAC name is N-ethyl-1,2-dihydropyrazine-5-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-1,2-dihydropyrazine-5-carboxamide |
| PubChem CID | 122522531 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | N-ethyl-1,2-dihydropyrazine-5-carboxamide |
| SMILES | CCNC(=O)C1=CNCC=N1 |
| InChI | InChI=1S/C7H11N3O/c1-2-9-7(11)6-5-8-3-4-10-6/h4-5,8H,2-3H2,1H3,(H,9,11) |
| InChIKey | JQFKCYZCLDDUOI-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-1,2-dihydropyrazine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1,2-dihydropyrazine-5-carboxamide?
The IUPAC name of N-ethyl-1,2-dihydropyrazine-5-carboxamide (CID 122522531) is N-ethyl-1,2-dihydropyrazine-5-carboxamide.
What is the SMILES notation for N-ethyl-1,2-dihydropyrazine-5-carboxamide?
The canonical SMILES for N-ethyl-1,2-dihydropyrazine-5-carboxamide is CCNC(=O)C1=CNCC=N1.
What is the InChIKey of N-ethyl-1,2-dihydropyrazine-5-carboxamide?
The InChIKey is JQFKCYZCLDDUOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O/c1-2-9-7(11)6-5-8-3-4-10-6/h4-5,8H,2-3H2,1H3,(H,9,11).
What are the key properties of N-ethyl-1,2-dihydropyrazine-5-carboxamide?
N-ethyl-1,2-dihydropyrazine-5-carboxamide has a molecular weight of 153.19 g/mol, XLogP of -0.36, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1,2-dihydropyrazine-5-carboxamide is sourced from PubChem (CID 122522531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).