C21H19ClN6O4S — CID 122522583
tert-butyl 2-[3-[5-[(4-chloro-1H-indazol-5-yl)amino]-1,3,4-thiadiazol-2-yl]-5-nitrophenyl]acetate (PubChem CID 122522583) has the molecular formula C21H19ClN6O4S and a molecular weight of 486.94 g/mol. Its IUPAC name is tert-butyl 2-[3-[5-[(4-chloro-1H-indazol-5-yl)amino]-1,3,4-thiadiazol-2-yl]-5-nitrophenyl]acetate.
| Compound Name | tert-butyl 2-[3-[5-[(4-chloro-1H-indazol-5-yl)amino]-1,3,4-thiadiazol-2-yl]-5-nitrophenyl]acetate |
|---|---|
| PubChem CID | 122522583 |
| Molecular Formula | C21H19ClN6O4S |
| Molecular Weight | 486.94 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | tert-butyl 2-[3-[5-[(4-chloro-1H-indazol-5-yl)amino]-1,3,4-thiadiazol-2-yl]-5-nitrophenyl]acetate |
| SMILES | CC(C)(C)OC(=O)Cc1cc(-c2nnc(Nc3ccc4[nH]ncc4c3Cl)s2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H19ClN6O4S/c1-21(2,3)32-17(29)8-11-6-12(9-13(7-11)28(30)31)19-26-27-20(33-19)24-16-5-4-15-14(18(16)22)10-23-25-15/h4-7,9-10H,8H2,1-3H3,(H,23,25)(H,24,27) |
| InChIKey | POYWDMUJJVUDII-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 135.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.94 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|