C20H16ClF3N6O — CID 122522816
4-[5-chloro-2-[[2-oxo-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-3-yl]methyl]pyrrolo[3,2-b]pyridin-1-yl]butanenitrile (PubChem CID 122522816) has the molecular formula C20H16ClF3N6O and a molecular weight of 448.84 g/mol. Its IUPAC name is 4-[5-chloro-2-[[2-oxo-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-3-yl]methyl]pyrrolo[3,2-b]pyridin-1-yl]butanenitrile.
| Compound Name | 4-[5-chloro-2-[[2-oxo-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-3-yl]methyl]pyrrolo[3,2-b]pyridin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 122522816 |
| Molecular Formula | C20H16ClF3N6O |
| Molecular Weight | 448.84 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 4-[5-chloro-2-[[2-oxo-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-3-yl]methyl]pyrrolo[3,2-b]pyridin-1-yl]butanenitrile |
| SMILES | N#CCCCn1c(Cn2c(=O)n(CC(F)(F)F)c3ccncc32)cc2nc(Cl)ccc21 |
| InChI | InChI=1S/C20H16ClF3N6O/c21-18-4-3-15-14(27-18)9-13(28(15)8-2-1-6-25)11-29-17-10-26-7-5-16(17)30(19(29)31)12-20(22,23)24/h3-5,7,9-10H,1-2,8,11-12H2 |
| InChIKey | MEJHLYWANJUDQG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 81.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.84 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|