C25H34O3 — CID 122522934
[4-(4-butan-2-yloxy-3,5-dimethylphenyl)-2,6-dimethylphenyl] 2,2-dimethylpropanoate (PubChem CID 122522934) has the molecular formula C25H34O3 and a molecular weight of 382.54 g/mol. Its IUPAC name is [4-(4-butan-2-yloxy-3,5-dimethylphenyl)-2,6-dimethylphenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-(4-butan-2-yloxy-3,5-dimethylphenyl)-2,6-dimethylphenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 122522934 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | [4-(4-butan-2-yloxy-3,5-dimethylphenyl)-2,6-dimethylphenyl] 2,2-dimethylpropanoate |
| SMILES | CCC(C)Oc1c(C)cc(-c2cc(C)c(OC(=O)C(C)(C)C)c(C)c2)cc1C |
| InChI | InChI=1S/C25H34O3/c1-10-19(6)27-22-15(2)11-20(12-16(22)3)21-13-17(4)23(18(5)14-21)28-24(26)25(7,8)9/h11-14,19H,10H2,1-9H3 |
| InChIKey | QPPVZNJRLJRQJE-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|