C21H18ClF5N4O — CID 122522950
3-[[5-chloro-1-(4-fluorobutyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]-5-fluoro-1-(2,2,2-trifluoroethyl)benzimidazol-2-one (PubChem CID 122522950) has the molecular formula C21H18ClF5N4O and a molecular weight of 472.85 g/mol. Its IUPAC name is 3-[[5-chloro-1-(4-fluorobutyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]-5-fluoro-1-(2,2,2-trifluoroethyl)benzimidazol-2-one.
| Compound Name | 3-[[5-chloro-1-(4-fluorobutyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]-5-fluoro-1-(2,2,2-trifluoroethyl)benzimidazol-2-one |
|---|---|
| PubChem CID | 122522950 |
| Molecular Formula | C21H18ClF5N4O |
| Molecular Weight | 472.85 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 3-[[5-chloro-1-(4-fluorobutyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]-5-fluoro-1-(2,2,2-trifluoroethyl)benzimidazol-2-one |
| SMILES | O=c1n(Cc2cc3nc(Cl)ccc3n2CCCCF)c2cc(F)ccc2n1CC(F)(F)F |
| InChI | InChI=1S/C21H18ClF5N4O/c22-19-6-5-16-15(28-19)10-14(29(16)8-2-1-7-23)11-30-18-9-13(24)3-4-17(18)31(20(30)32)12-21(25,26)27/h3-6,9-10H,1-2,7-8,11-12H2 |
| InChIKey | PHOPXXISUJEALZ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 44.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.85 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|