About [4-[3-methyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentyl]phenyl] 2-methylbutanoate
[4-[3-methyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentyl]phenyl] 2-methylbutanoate (PubChem CID 122522982) has the molecular formula C27H38O3
and a molecular weight of 410.60 g/mol. Its IUPAC name is [4-[3-methyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentyl]phenyl] 2-methylbutanoate.
Molecular Properties
| Compound Name | [4-[3-methyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentyl]phenyl] 2-methylbutanoate |
| PubChem CID | 122522982 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | [4-[3-methyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentyl]phenyl] 2-methylbutanoate |
| SMILES | CCC(C)CC(c1ccc(OC(=O)C(C)CC)cc1)c1ccc(OC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H38O3/c1-8-19(3)18-25(22-12-16-24(17-13-22)30-27(5,6)7)21-10-14-23(15-11-21)29-26(28)20(4)9-2/h10-17,19-20,25H,8-9,18H2,1-7H3 |
| InChIKey | GDINJOYXEWPLLV-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[3-methyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentyl]phenyl] 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-methyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentyl]phenyl] 2-methylbutanoate?
The IUPAC name of [4-[3-methyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentyl]phenyl] 2-methylbutanoate (CID 122522982) is [4-[3-methyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentyl]phenyl] 2-methylbutanoate.
What is the SMILES notation for [4-[3-methyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentyl]phenyl] 2-methylbutanoate?
The canonical SMILES for [4-[3-methyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentyl]phenyl] 2-methylbutanoate is CCC(C)CC(c1ccc(OC(=O)C(C)CC)cc1)c1ccc(OC(C)(C)C)cc1.
What is the InChIKey of [4-[3-methyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentyl]phenyl] 2-methylbutanoate?
The InChIKey is GDINJOYXEWPLLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H38O3/c1-8-19(3)18-25(22-12-16-24(17-13-22)30-27(5,6)7)21-10-14-23(15-11-21)29-26(28)20(4)9-2/h10-17,19-20,25H,8-9,18H2,1-7H3.
What are the key properties of [4-[3-methyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentyl]phenyl] 2-methylbutanoate?
[4-[3-methyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentyl]phenyl] 2-methylbutanoate has a molecular weight of 410.60 g/mol, XLogP of 7.38, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-methyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentyl]phenyl] 2-methylbutanoate is sourced from PubChem (CID 122522982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).