C21H30O4S — CID 122523168
2-[(2Z,6Z)-8-(benzenesulfonyl)-2,6-dimethylocta-2,6-dienoxy]oxane (PubChem CID 122523168) has the molecular formula C21H30O4S and a molecular weight of 378.53 g/mol. Its IUPAC name is 2-[(2Z,6Z)-8-(benzenesulfonyl)-2,6-dimethylocta-2,6-dienoxy]oxane.
| Compound Name | 2-[(2Z,6Z)-8-(benzenesulfonyl)-2,6-dimethylocta-2,6-dienoxy]oxane |
|---|---|
| PubChem CID | 122523168 |
| Molecular Formula | C21H30O4S |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 2-[(2Z,6Z)-8-(benzenesulfonyl)-2,6-dimethylocta-2,6-dienoxy]oxane |
| SMILES | C/C(=C/CS(=O)(=O)c1ccccc1)CC/C=C(/C)COC1CCCCO1 |
| InChI | InChI=1S/C21H30O4S/c1-18(14-16-26(22,23)20-11-4-3-5-12-20)9-8-10-19(2)17-25-21-13-6-7-15-24-21/h3-5,10-12,14,21H,6-9,13,15-17H2,1-2H3/b18-14-,19-10- |
| InChIKey | XTISQTRZLPKJBL-HZDFXEKWSA-N |
| XLogP | 4.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|