About (6Z)-N-tert-butyl-6-(2,2-dimethylpropylidene)cyclohexa-2,4-dien-1-imine
(6Z)-N-tert-butyl-6-(2,2-dimethylpropylidene)cyclohexa-2,4-dien-1-imine (PubChem CID 122523753) has the molecular formula C15H23N
and a molecular weight of 217.36 g/mol. Its IUPAC name is (6Z)-N-tert-butyl-6-(2,2-dimethylpropylidene)cyclohexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | (6Z)-N-tert-butyl-6-(2,2-dimethylpropylidene)cyclohexa-2,4-dien-1-imine |
| PubChem CID | 122523753 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (6Z)-N-tert-butyl-6-(2,2-dimethylpropylidene)cyclohexa-2,4-dien-1-imine |
| SMILES | CC(C)(C)/C=C1/C=CC=C/C1=N\C(C)(C)C |
| InChI | InChI=1S/C15H23N/c1-14(2,3)11-12-9-7-8-10-13(12)16-15(4,5)6/h7-11H,1-6H3/b12-11-,16-13+ |
| InChIKey | XWHYXNPCFOSDIY-PAZXJHTRSA-N |
| XLogP | 4.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-N-tert-butyl-6-(2,2-dimethylpropylidene)cyclohexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-N-tert-butyl-6-(2,2-dimethylpropylidene)cyclohexa-2,4-dien-1-imine?
The IUPAC name of (6Z)-N-tert-butyl-6-(2,2-dimethylpropylidene)cyclohexa-2,4-dien-1-imine (CID 122523753) is (6Z)-N-tert-butyl-6-(2,2-dimethylpropylidene)cyclohexa-2,4-dien-1-imine.
What is the SMILES notation for (6Z)-N-tert-butyl-6-(2,2-dimethylpropylidene)cyclohexa-2,4-dien-1-imine?
The canonical SMILES for (6Z)-N-tert-butyl-6-(2,2-dimethylpropylidene)cyclohexa-2,4-dien-1-imine is CC(C)(C)/C=C1/C=CC=C/C1=N\C(C)(C)C.
What is the InChIKey of (6Z)-N-tert-butyl-6-(2,2-dimethylpropylidene)cyclohexa-2,4-dien-1-imine?
The InChIKey is XWHYXNPCFOSDIY-PAZXJHTRSA-N. The full InChI is InChI=1S/C15H23N/c1-14(2,3)11-12-9-7-8-10-13(12)16-15(4,5)6/h7-11H,1-6H3/b12-11-,16-13+.
What are the key properties of (6Z)-N-tert-butyl-6-(2,2-dimethylpropylidene)cyclohexa-2,4-dien-1-imine?
(6Z)-N-tert-butyl-6-(2,2-dimethylpropylidene)cyclohexa-2,4-dien-1-imine has a molecular weight of 217.36 g/mol, XLogP of 4.32, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-N-tert-butyl-6-(2,2-dimethylpropylidene)cyclohexa-2,4-dien-1-imine is sourced from PubChem (CID 122523753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).