C20H22N4O6 — CID 122525081
4-O-(azidomethyl) 1-O-methyl 2-[2-(6-methoxynaphthalen-2-yl)propanoylamino]butanedioate (PubChem CID 122525081) has the molecular formula C20H22N4O6 and a molecular weight of 414.42 g/mol. Its IUPAC name is 4-O-(azidomethyl) 1-O-methyl 2-[2-(6-methoxynaphthalen-2-yl)propanoylamino]butanedioate.
| Compound Name | 4-O-(azidomethyl) 1-O-methyl 2-[2-(6-methoxynaphthalen-2-yl)propanoylamino]butanedioate |
|---|---|
| PubChem CID | 122525081 |
| Molecular Formula | C20H22N4O6 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 4-O-(azidomethyl) 1-O-methyl 2-[2-(6-methoxynaphthalen-2-yl)propanoylamino]butanedioate |
| SMILES | COC(=O)C(CC(=O)OCN=[N+]=[N-])NC(=O)C(C)c1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C20H22N4O6/c1-12(13-4-5-15-9-16(28-2)7-6-14(15)8-13)19(26)23-17(20(27)29-3)10-18(25)30-11-22-24-21/h4-9,12,17H,10-11H2,1-3H3,(H,23,26) |
| InChIKey | KZEFHCNKUJKZNC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 139.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|