About 2-[(1S,6R)-3-chloro-6-nitrocyclohex-3-en-1-yl]-1,3-dioxolane
2-[(1S,6R)-3-chloro-6-nitrocyclohex-3-en-1-yl]-1,3-dioxolane (PubChem CID 122525158) has the molecular formula C9H12ClNO4
and a molecular weight of 233.65 g/mol. Its IUPAC name is 2-[(1S,6R)-3-chloro-6-nitrocyclohex-3-en-1-yl]-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-[(1S,6R)-3-chloro-6-nitrocyclohex-3-en-1-yl]-1,3-dioxolane |
| PubChem CID | 122525158 |
| Molecular Formula | C9H12ClNO4 |
| Molecular Weight | 233.65 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 2-[(1S,6R)-3-chloro-6-nitrocyclohex-3-en-1-yl]-1,3-dioxolane |
| SMILES | O=[N+]([O-])[C@@H]1CC=C(Cl)C[C@@H]1C1OCCO1 |
| InChI | InChI=1S/C9H12ClNO4/c10-6-1-2-8(11(12)13)7(5-6)9-14-3-4-15-9/h1,7-9H,2-5H2/t7-,8+/m0/s1 |
| InChIKey | IMETWGGHKKLUMF-JGVFFNPUSA-N |
| XLogP | 1.54 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.65 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1S,6R)-3-chloro-6-nitrocyclohex-3-en-1-yl]-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,6R)-3-chloro-6-nitrocyclohex-3-en-1-yl]-1,3-dioxolane?
The IUPAC name of 2-[(1S,6R)-3-chloro-6-nitrocyclohex-3-en-1-yl]-1,3-dioxolane (CID 122525158) is 2-[(1S,6R)-3-chloro-6-nitrocyclohex-3-en-1-yl]-1,3-dioxolane.
What is the SMILES notation for 2-[(1S,6R)-3-chloro-6-nitrocyclohex-3-en-1-yl]-1,3-dioxolane?
The canonical SMILES for 2-[(1S,6R)-3-chloro-6-nitrocyclohex-3-en-1-yl]-1,3-dioxolane is O=[N+]([O-])[C@@H]1CC=C(Cl)C[C@@H]1C1OCCO1.
What is the InChIKey of 2-[(1S,6R)-3-chloro-6-nitrocyclohex-3-en-1-yl]-1,3-dioxolane?
The InChIKey is IMETWGGHKKLUMF-JGVFFNPUSA-N. The full InChI is InChI=1S/C9H12ClNO4/c10-6-1-2-8(11(12)13)7(5-6)9-14-3-4-15-9/h1,7-9H,2-5H2/t7-,8+/m0/s1.
What are the key properties of 2-[(1S,6R)-3-chloro-6-nitrocyclohex-3-en-1-yl]-1,3-dioxolane?
2-[(1S,6R)-3-chloro-6-nitrocyclohex-3-en-1-yl]-1,3-dioxolane has a molecular weight of 233.65 g/mol, XLogP of 1.54, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,6R)-3-chloro-6-nitrocyclohex-3-en-1-yl]-1,3-dioxolane is sourced from PubChem (CID 122525158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).