About 2-N-ethyl-1-N-methylcyclohexa-3,5-diene-1,2-diimine
2-N-ethyl-1-N-methylcyclohexa-3,5-diene-1,2-diimine (PubChem CID 122525288) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 2-N-ethyl-1-N-methylcyclohexa-3,5-diene-1,2-diimine.
Molecular Properties
| Compound Name | 2-N-ethyl-1-N-methylcyclohexa-3,5-diene-1,2-diimine |
| PubChem CID | 122525288 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 2-N-ethyl-1-N-methylcyclohexa-3,5-diene-1,2-diimine |
| SMILES | CC/N=C1\C=CC=C\C1=N/C |
| InChI | InChI=1S/C9H12N2/c1-3-11-9-7-5-4-6-8(9)10-2/h4-7H,3H2,1-2H3/b10-8+,11-9+ |
| InChIKey | RIWMQDQYACJFEH-GFULKKFKSA-N |
| XLogP | 1.64 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-N-ethyl-1-N-methylcyclohexa-3,5-diene-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-ethyl-1-N-methylcyclohexa-3,5-diene-1,2-diimine?
The IUPAC name of 2-N-ethyl-1-N-methylcyclohexa-3,5-diene-1,2-diimine (CID 122525288) is 2-N-ethyl-1-N-methylcyclohexa-3,5-diene-1,2-diimine.
What is the SMILES notation for 2-N-ethyl-1-N-methylcyclohexa-3,5-diene-1,2-diimine?
The canonical SMILES for 2-N-ethyl-1-N-methylcyclohexa-3,5-diene-1,2-diimine is CC/N=C1\C=CC=C\C1=N/C.
What is the InChIKey of 2-N-ethyl-1-N-methylcyclohexa-3,5-diene-1,2-diimine?
The InChIKey is RIWMQDQYACJFEH-GFULKKFKSA-N. The full InChI is InChI=1S/C9H12N2/c1-3-11-9-7-5-4-6-8(9)10-2/h4-7H,3H2,1-2H3/b10-8+,11-9+.
What are the key properties of 2-N-ethyl-1-N-methylcyclohexa-3,5-diene-1,2-diimine?
2-N-ethyl-1-N-methylcyclohexa-3,5-diene-1,2-diimine has a molecular weight of 148.21 g/mol, XLogP of 1.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-ethyl-1-N-methylcyclohexa-3,5-diene-1,2-diimine is sourced from PubChem (CID 122525288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).