C22H32O4 — CID 122526993
(4E,6Z)-9-methoxy-4-[1-(3-prop-2-enoxybut-3-enoxy)ethenyl]-6-prop-1-en-2-ylnona-4,6-dienal (PubChem CID 122526993) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (4E,6Z)-9-methoxy-4-[1-(3-prop-2-enoxybut-3-enoxy)ethenyl]-6-prop-1-en-2-ylnona-4,6-dienal.
| Compound Name | (4E,6Z)-9-methoxy-4-[1-(3-prop-2-enoxybut-3-enoxy)ethenyl]-6-prop-1-en-2-ylnona-4,6-dienal |
|---|---|
| PubChem CID | 122526993 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (4E,6Z)-9-methoxy-4-[1-(3-prop-2-enoxybut-3-enoxy)ethenyl]-6-prop-1-en-2-ylnona-4,6-dienal |
| SMILES | C=CCOC(=C)CCOC(=C)/C(=C\C(=C\CCOC)C(=C)C)CCC=O |
| InChI | InChI=1S/C22H32O4/c1-7-14-25-19(4)12-16-26-20(5)22(10-8-13-23)17-21(18(2)3)11-9-15-24-6/h7,11,13,17H,1-2,4-5,8-10,12,14-16H2,3,6H3/b21-11-,22-17+ |
| InChIKey | FFSIEFNSNCSLLP-JRPFOSPMSA-N |
| XLogP | 5.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|