C26H30O5 — CID 122527107
6-[(2E)-3,7-dimethylocta-2,6-dienyl]-5,7-dihydroxy-2-(3-hydroxy-4-methylphenyl)-2,3-dihydrochromen-4-one (PubChem CID 122527107) has the molecular formula C26H30O5 and a molecular weight of 422.52 g/mol. Its IUPAC name is 6-[(2E)-3,7-dimethylocta-2,6-dienyl]-5,7-dihydroxy-2-(3-hydroxy-4-methylphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | 6-[(2E)-3,7-dimethylocta-2,6-dienyl]-5,7-dihydroxy-2-(3-hydroxy-4-methylphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 122527107 |
| Molecular Formula | C26H30O5 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 6-[(2E)-3,7-dimethylocta-2,6-dienyl]-5,7-dihydroxy-2-(3-hydroxy-4-methylphenyl)-2,3-dihydrochromen-4-one |
| SMILES | CC(C)=CCC/C(C)=C/Cc1c(O)cc2c(c1O)C(=O)CC(c1ccc(C)c(O)c1)O2 |
| InChI | InChI=1S/C26H30O5/c1-15(2)6-5-7-16(3)8-11-19-21(28)13-24-25(26(19)30)22(29)14-23(31-24)18-10-9-17(4)20(27)12-18/h6,8-10,12-13,23,27-28,30H,5,7,11,14H2,1-4H3/b16-8+ |
| InChIKey | YHVPDSAAVKGHCW-LZYBPNLTSA-N |
| XLogP | 6.05 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|