C15H27N19 — CID 122527806
2-N-[2-[[4-amino-6-[2-[[4-amino-6-(2-aminoethylamino)-1,3,5-triazin-2-yl]amino]ethylamino]-1,3,5-triazin-2-yl]amino]ethyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 122527806) has the molecular formula C15H27N19 and a molecular weight of 473.51 g/mol. Its IUPAC name is 2-N-[2-[[4-amino-6-[2-[[4-amino-6-(2-aminoethylamino)-1,3,5-triazin-2-yl]amino]ethylamino]-1,3,5-triazin-2-yl]amino]ethyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[2-[[4-amino-6-[2-[[4-amino-6-(2-aminoethylamino)-1,3,5-triazin-2-yl]amino]ethylamino]-1,3,5-triazin-2-yl]amino]ethyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 122527806 |
| Molecular Formula | C15H27N19 |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | 2-N-[2-[[4-amino-6-[2-[[4-amino-6-(2-aminoethylamino)-1,3,5-triazin-2-yl]amino]ethylamino]-1,3,5-triazin-2-yl]amino]ethyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | NCCNc1nc(N)nc(NCCNc2nc(N)nc(NCCNc3nc(N)nc(N)n3)n2)n1 |
| InChI | InChI=1S/C15H27N19/c16-1-2-21-12-29-9(19)30-13(33-12)24-5-6-25-15-32-10(20)31-14(34-15)23-4-3-22-11-27-7(17)26-8(18)28-11/h1-6,16H2,(H5,17,18,22,26,27,28)(H4,19,21,24,29,30,33)(H4,20,23,25,31,32,34) |
| InChIKey | MZZFQONBTZYEAI-UHFFFAOYSA-N |
| XLogP | -3.01 |
| TPSA | 306.26 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|