C11H7F7N4 — CID 122528598
4-[5-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-1,2,4-triazol-3-yl]aniline (PubChem CID 122528598) has the molecular formula C11H7F7N4 and a molecular weight of 328.19 g/mol. Its IUPAC name is 4-[5-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-1,2,4-triazol-3-yl]aniline.
| Compound Name | 4-[5-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 122528598 |
| Molecular Formula | C11H7F7N4 |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 4-[5-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-1,2,4-triazol-3-yl]aniline |
| SMILES | Nc1ccc(-c2n[nH]c(C(F)(F)C(F)(F)C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C11H7F7N4/c12-9(13,10(14,15)11(16,17)18)8-20-7(21-22-8)5-1-3-6(19)4-2-5/h1-4H,19H2,(H,20,21,22) |
| InChIKey | XVRXVWFWFXRWSP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|