About phenazine;1,3-thiazole
phenazine;1,3-thiazole (PubChem CID 122528852) has the molecular formula C15H11N3S
and a molecular weight of 265.34 g/mol. Its IUPAC name is phenazine;1,3-thiazole.
Molecular Properties
| Compound Name | phenazine;1,3-thiazole |
| PubChem CID | 122528852 |
| Molecular Formula | C15H11N3S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | phenazine;1,3-thiazole |
| SMILES | c1ccc2nc3ccccc3nc2c1.c1cscn1 |
| InChI | InChI=1S/C12H8N2.C3H3NS/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;1-2-5-3-4-1/h1-8H;1-3H |
| InChIKey | BJTHLILARPDLEJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze phenazine;1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenazine;1,3-thiazole?
The IUPAC name of phenazine;1,3-thiazole (CID 122528852) is phenazine;1,3-thiazole.
What is the SMILES notation for phenazine;1,3-thiazole?
The canonical SMILES for phenazine;1,3-thiazole is c1ccc2nc3ccccc3nc2c1.c1cscn1.
What is the InChIKey of phenazine;1,3-thiazole?
The InChIKey is BJTHLILARPDLEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.C3H3NS/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;1-2-5-3-4-1/h1-8H;1-3H.
What are the key properties of phenazine;1,3-thiazole?
phenazine;1,3-thiazole has a molecular weight of 265.34 g/mol, XLogP of 3.93, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenazine;1,3-thiazole is sourced from PubChem (CID 122528852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).