About 3-fluoro-4-[3-[2-(trifluoromethyl)benzoyl]imidazo[1,5-a]pyridin-1-yl]benzoic acid
3-fluoro-4-[3-[2-(trifluoromethyl)benzoyl]imidazo[1,5-a]pyridin-1-yl]benzoic acid (PubChem CID 122529830) has the molecular formula C22H12F4N2O3
and a molecular weight of 428.34 g/mol. Its IUPAC name is 3-fluoro-4-[3-[2-(trifluoromethyl)benzoyl]imidazo[1,5-a]pyridin-1-yl]benzoic acid.
Molecular Properties
| Compound Name | 3-fluoro-4-[3-[2-(trifluoromethyl)benzoyl]imidazo[1,5-a]pyridin-1-yl]benzoic acid |
| PubChem CID | 122529830 |
| Molecular Formula | C22H12F4N2O3 |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 3-fluoro-4-[3-[2-(trifluoromethyl)benzoyl]imidazo[1,5-a]pyridin-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2nc(C(=O)c3ccccc3C(F)(F)F)n3ccccc23)c(F)c1 |
| InChI | InChI=1S/C22H12F4N2O3/c23-16-11-12(21(30)31)8-9-14(16)18-17-7-3-4-10-28(17)20(27-18)19(29)13-5-1-2-6-15(13)22(24,25)26/h1-11H,(H,30,31) |
| InChIKey | KYLXFVCMWJMZJG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-fluoro-4-[3-[2-(trifluoromethyl)benzoyl]imidazo[1,5-a]pyridin-1-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-[3-[2-(trifluoromethyl)benzoyl]imidazo[1,5-a]pyridin-1-yl]benzoic acid?
The IUPAC name of 3-fluoro-4-[3-[2-(trifluoromethyl)benzoyl]imidazo[1,5-a]pyridin-1-yl]benzoic acid (CID 122529830) is 3-fluoro-4-[3-[2-(trifluoromethyl)benzoyl]imidazo[1,5-a]pyridin-1-yl]benzoic acid.
What is the SMILES notation for 3-fluoro-4-[3-[2-(trifluoromethyl)benzoyl]imidazo[1,5-a]pyridin-1-yl]benzoic acid?
The canonical SMILES for 3-fluoro-4-[3-[2-(trifluoromethyl)benzoyl]imidazo[1,5-a]pyridin-1-yl]benzoic acid is O=C(O)c1ccc(-c2nc(C(=O)c3ccccc3C(F)(F)F)n3ccccc23)c(F)c1.
What is the InChIKey of 3-fluoro-4-[3-[2-(trifluoromethyl)benzoyl]imidazo[1,5-a]pyridin-1-yl]benzoic acid?
The InChIKey is KYLXFVCMWJMZJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H12F4N2O3/c23-16-11-12(21(30)31)8-9-14(16)18-17-7-3-4-10-28(17)20(27-18)19(29)13-5-1-2-6-15(13)22(24,25)26/h1-11H,(H,30,31).
What are the key properties of 3-fluoro-4-[3-[2-(trifluoromethyl)benzoyl]imidazo[1,5-a]pyridin-1-yl]benzoic acid?
3-fluoro-4-[3-[2-(trifluoromethyl)benzoyl]imidazo[1,5-a]pyridin-1-yl]benzoic acid has a molecular weight of 428.34 g/mol, XLogP of 5.09, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-[3-[2-(trifluoromethyl)benzoyl]imidazo[1,5-a]pyridin-1-yl]benzoic acid is sourced from PubChem (CID 122529830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).