C22H24F9N3O4 — CID 122530003
(3R)-1-[3-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-(trifluoromethyl)phenyl]piperidine-3-carboxylic acid (PubChem CID 122530003) has the molecular formula C22H24F9N3O4 and a molecular weight of 565.43 g/mol. Its IUPAC name is (3R)-1-[3-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-(trifluoromethyl)phenyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[3-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-(trifluoromethyl)phenyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122530003 |
| Molecular Formula | C22H24F9N3O4 |
| Molecular Weight | 565.43 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | (3R)-1-[3-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-(trifluoromethyl)phenyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN(c2cc(CN3CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC3)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C22H24F9N3O4/c23-20(24,25)15-8-13(9-16(10-15)34-3-1-2-14(12-34)17(35)36)11-32-4-6-33(7-5-32)19(37)38-18(21(26,27)28)22(29,30)31/h8-10,14,18H,1-7,11-12H2,(H,35,36)/t14-/m1/s1 |
| InChIKey | SBZHBKSZOCPSJY-CQSZACIVSA-N |
| XLogP | 4.75 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |