C33H32N4O6 — CID 122531527
tert-butyl N-[(3S)-5-[(2-methylnaphthalen-1-yl)methyl]-1-(4-nitrobenzoyl)-4-oxo-2,3-dihydro-1,5-benzodiazepin-3-yl]carbamate (PubChem CID 122531527) has the molecular formula C33H32N4O6 and a molecular weight of 580.64 g/mol. Its IUPAC name is tert-butyl N-[(3S)-5-[(2-methylnaphthalen-1-yl)methyl]-1-(4-nitrobenzoyl)-4-oxo-2,3-dihydro-1,5-benzodiazepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-5-[(2-methylnaphthalen-1-yl)methyl]-1-(4-nitrobenzoyl)-4-oxo-2,3-dihydro-1,5-benzodiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 122531527 |
| Molecular Formula | C33H32N4O6 |
| Molecular Weight | 580.64 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | tert-butyl N-[(3S)-5-[(2-methylnaphthalen-1-yl)methyl]-1-(4-nitrobenzoyl)-4-oxo-2,3-dihydro-1,5-benzodiazepin-3-yl]carbamate |
| SMILES | Cc1ccc2ccccc2c1CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)CN(C(=O)c2ccc([N+](=O)[O-])cc2)c2ccccc21 |
| InChI | InChI=1S/C33H32N4O6/c1-21-13-14-22-9-5-6-10-25(22)26(21)19-35-28-11-7-8-12-29(28)36(30(38)23-15-17-24(18-16-23)37(41)42)20-27(31(35)39)34-32(40)43-33(2,3)4/h5-18,27H,19-20H2,1-4H3,(H,34,40)/t27-/m0/s1 |
| InChIKey | UNYYVRDDBIWRPM-MHZLTWQESA-N |
| XLogP | 6.14 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.64 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|