About 5-amino-N,N-dimethyl-2-methylidenepentanamide;methyl benzenesulfonate
5-amino-N,N-dimethyl-2-methylidenepentanamide;methyl benzenesulfonate (PubChem CID 122531703) has the molecular formula C15H24N2O4S
and a molecular weight of 328.43 g/mol. Its IUPAC name is 5-amino-N,N-dimethyl-2-methylidenepentanamide;methyl benzenesulfonate.
Molecular Properties
| Compound Name | 5-amino-N,N-dimethyl-2-methylidenepentanamide;methyl benzenesulfonate |
| PubChem CID | 122531703 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 5-amino-N,N-dimethyl-2-methylidenepentanamide;methyl benzenesulfonate |
| SMILES | C=C(CCCN)C(=O)N(C)C.COS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C8H16N2O.C7H8O3S/c1-7(5-4-6-9)8(11)10(2)3;1-10-11(8,9)7-5-3-2-4-6-7/h1,4-6,9H2,2-3H3;2-6H,1H3 |
| InChIKey | KJEPJXUUNSPVPD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-N,N-dimethyl-2-methylidenepentanamide;methyl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N,N-dimethyl-2-methylidenepentanamide;methyl benzenesulfonate?
The IUPAC name of 5-amino-N,N-dimethyl-2-methylidenepentanamide;methyl benzenesulfonate (CID 122531703) is 5-amino-N,N-dimethyl-2-methylidenepentanamide;methyl benzenesulfonate.
What is the SMILES notation for 5-amino-N,N-dimethyl-2-methylidenepentanamide;methyl benzenesulfonate?
The canonical SMILES for 5-amino-N,N-dimethyl-2-methylidenepentanamide;methyl benzenesulfonate is C=C(CCCN)C(=O)N(C)C.COS(=O)(=O)c1ccccc1.
What is the InChIKey of 5-amino-N,N-dimethyl-2-methylidenepentanamide;methyl benzenesulfonate?
The InChIKey is KJEPJXUUNSPVPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O.C7H8O3S/c1-7(5-4-6-9)8(11)10(2)3;1-10-11(8,9)7-5-3-2-4-6-7/h1,4-6,9H2,2-3H3;2-6H,1H3.
What are the key properties of 5-amino-N,N-dimethyl-2-methylidenepentanamide;methyl benzenesulfonate?
5-amino-N,N-dimethyl-2-methylidenepentanamide;methyl benzenesulfonate has a molecular weight of 328.43 g/mol, XLogP of 1.39, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N,N-dimethyl-2-methylidenepentanamide;methyl benzenesulfonate is sourced from PubChem (CID 122531703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).