C17H21BrN4 — CID 122531755
3-bromo-4-ethyl-5-(3-piperazin-1-ylphenyl)pyridin-2-amine (PubChem CID 122531755) has the molecular formula C17H21BrN4 and a molecular weight of 361.29 g/mol. Its IUPAC name is 3-bromo-4-ethyl-5-(3-piperazin-1-ylphenyl)pyridin-2-amine.
| Compound Name | 3-bromo-4-ethyl-5-(3-piperazin-1-ylphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 122531755 |
| Molecular Formula | C17H21BrN4 |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 3-bromo-4-ethyl-5-(3-piperazin-1-ylphenyl)pyridin-2-amine |
| SMILES | CCc1c(-c2cccc(N3CCNCC3)c2)cnc(N)c1Br |
| InChI | InChI=1S/C17H21BrN4/c1-2-14-15(11-21-17(19)16(14)18)12-4-3-5-13(10-12)22-8-6-20-7-9-22/h3-5,10-11,20H,2,6-9H2,1H3,(H2,19,21) |
| InChIKey | DUEXNHFBAQCFQL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |