About 1-[5-ethyl-4-fluoro-2-(3,3,3-trifluoro-2-hydroxypropoxy)phenyl]-4-methyltetrazol-5-one
1-[5-ethyl-4-fluoro-2-(3,3,3-trifluoro-2-hydroxypropoxy)phenyl]-4-methyltetrazol-5-one (PubChem CID 122531861) has the molecular formula C13H14F4N4O3
and a molecular weight of 350.27 g/mol. Its IUPAC name is 1-[5-ethyl-4-fluoro-2-(3,3,3-trifluoro-2-hydroxypropoxy)phenyl]-4-methyltetrazol-5-one.
Molecular Properties
| Compound Name | 1-[5-ethyl-4-fluoro-2-(3,3,3-trifluoro-2-hydroxypropoxy)phenyl]-4-methyltetrazol-5-one |
| PubChem CID | 122531861 |
| Molecular Formula | C13H14F4N4O3 |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 1-[5-ethyl-4-fluoro-2-(3,3,3-trifluoro-2-hydroxypropoxy)phenyl]-4-methyltetrazol-5-one |
| SMILES | CCc1cc(-n2nnn(C)c2=O)c(OCC(O)C(F)(F)F)cc1F |
| InChI | InChI=1S/C13H14F4N4O3/c1-3-7-4-9(21-12(23)20(2)18-19-21)10(5-8(7)14)24-6-11(22)13(15,16)17/h4-5,11,22H,3,6H2,1-2H3 |
| InChIKey | UHGUETUGCVAPFW-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[5-ethyl-4-fluoro-2-(3,3,3-trifluoro-2-hydroxypropoxy)phenyl]-4-methyltetrazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-ethyl-4-fluoro-2-(3,3,3-trifluoro-2-hydroxypropoxy)phenyl]-4-methyltetrazol-5-one?
The IUPAC name of 1-[5-ethyl-4-fluoro-2-(3,3,3-trifluoro-2-hydroxypropoxy)phenyl]-4-methyltetrazol-5-one (CID 122531861) is 1-[5-ethyl-4-fluoro-2-(3,3,3-trifluoro-2-hydroxypropoxy)phenyl]-4-methyltetrazol-5-one.
What is the SMILES notation for 1-[5-ethyl-4-fluoro-2-(3,3,3-trifluoro-2-hydroxypropoxy)phenyl]-4-methyltetrazol-5-one?
The canonical SMILES for 1-[5-ethyl-4-fluoro-2-(3,3,3-trifluoro-2-hydroxypropoxy)phenyl]-4-methyltetrazol-5-one is CCc1cc(-n2nnn(C)c2=O)c(OCC(O)C(F)(F)F)cc1F.
What is the InChIKey of 1-[5-ethyl-4-fluoro-2-(3,3,3-trifluoro-2-hydroxypropoxy)phenyl]-4-methyltetrazol-5-one?
The InChIKey is UHGUETUGCVAPFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F4N4O3/c1-3-7-4-9(21-12(23)20(2)18-19-21)10(5-8(7)14)24-6-11(22)13(15,16)17/h4-5,11,22H,3,6H2,1-2H3.
What are the key properties of 1-[5-ethyl-4-fluoro-2-(3,3,3-trifluoro-2-hydroxypropoxy)phenyl]-4-methyltetrazol-5-one?
1-[5-ethyl-4-fluoro-2-(3,3,3-trifluoro-2-hydroxypropoxy)phenyl]-4-methyltetrazol-5-one has a molecular weight of 350.27 g/mol, XLogP of 0.97, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-ethyl-4-fluoro-2-(3,3,3-trifluoro-2-hydroxypropoxy)phenyl]-4-methyltetrazol-5-one is sourced from PubChem (CID 122531861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).