C12H15FN4O3 — CID 122531879
1-[5-ethyl-4-fluoro-2-(2-hydroxyethoxy)phenyl]-4-methyltetrazol-5-one (PubChem CID 122531879) has the molecular formula C12H15FN4O3 and a molecular weight of 282.28 g/mol. Its IUPAC name is 1-[5-ethyl-4-fluoro-2-(2-hydroxyethoxy)phenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[5-ethyl-4-fluoro-2-(2-hydroxyethoxy)phenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 122531879 |
| Molecular Formula | C12H15FN4O3 |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 1-[5-ethyl-4-fluoro-2-(2-hydroxyethoxy)phenyl]-4-methyltetrazol-5-one |
| SMILES | CCc1cc(-n2nnn(C)c2=O)c(OCCO)cc1F |
| InChI | InChI=1S/C12H15FN4O3/c1-3-8-6-10(17-12(19)16(2)14-15-17)11(7-9(8)13)20-5-4-18/h6-7,18H,3-5H2,1-2H3 |
| InChIKey | NIURLAKHPGLJOL-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |