About (3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl) acetate
(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl) acetate (PubChem CID 122532298) has the molecular formula C7H9NO4S
and a molecular weight of 203.22 g/mol. Its IUPAC name is (3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl) acetate.
Molecular Properties
| Compound Name | (3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl) acetate |
| PubChem CID | 122532298 |
| Molecular Formula | C7H9NO4S |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | (3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl) acetate |
| SMILES | CSC1CC(=O)N(OC(C)=O)C1=O |
| InChI | InChI=1S/C7H9NO4S/c1-4(9)12-8-6(10)3-5(13-2)7(8)11/h5H,3H2,1-2H3 |
| InChIKey | OLFVHSXXOJCHQN-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl) acetate?
The IUPAC name of (3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl) acetate (CID 122532298) is (3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl) acetate.
What is the SMILES notation for (3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl) acetate?
The canonical SMILES for (3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl) acetate is CSC1CC(=O)N(OC(C)=O)C1=O.
What is the InChIKey of (3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl) acetate?
The InChIKey is OLFVHSXXOJCHQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO4S/c1-4(9)12-8-6(10)3-5(13-2)7(8)11/h5H,3H2,1-2H3.
What are the key properties of (3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl) acetate?
(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl) acetate has a molecular weight of 203.22 g/mol, XLogP of -0.05, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl) acetate is sourced from PubChem (CID 122532298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).