C20H36N18 — CID 122532302
4-N-ethyl-2-N-[2-[[4-(ethylamino)-6-[2-[[4-(ethylamino)-6-(methylamino)-1,3,5-triazin-2-yl]amino]ethylamino]-1,3,5-triazin-2-yl]amino]ethyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 122532302) has the molecular formula C20H36N18 and a molecular weight of 528.63 g/mol. Its IUPAC name is 4-N-ethyl-2-N-[2-[[4-(ethylamino)-6-[2-[[4-(ethylamino)-6-(methylamino)-1,3,5-triazin-2-yl]amino]ethylamino]-1,3,5-triazin-2-yl]amino]ethyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-ethyl-2-N-[2-[[4-(ethylamino)-6-[2-[[4-(ethylamino)-6-(methylamino)-1,3,5-triazin-2-yl]amino]ethylamino]-1,3,5-triazin-2-yl]amino]ethyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 122532302 |
| Molecular Formula | C20H36N18 |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.34 |
| IUPAC Name | 4-N-ethyl-2-N-[2-[[4-(ethylamino)-6-[2-[[4-(ethylamino)-6-(methylamino)-1,3,5-triazin-2-yl]amino]ethylamino]-1,3,5-triazin-2-yl]amino]ethyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(N)nc(NCCNc2nc(NCC)nc(NCCNc3nc(NC)nc(NCC)n3)n2)n1 |
| InChI | InChI=1S/C20H36N18/c1-5-23-14-30-12(21)31-17(34-14)26-8-9-28-19-36-16(25-7-3)37-20(38-19)29-11-10-27-18-33-13(22-4)32-15(35-18)24-6-2/h5-11H2,1-4H3,(H4,21,23,26,30,31,34)(H3,22,24,27,32,33,35)(H3,25,28,29,36,37,38) |
| InChIKey | CXTXEPSXHZDPQN-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 238.27 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|