C13H20F2O — CID 122532314
4,6-difluoro-3-methyl-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzofuran (PubChem CID 122532314) has the molecular formula C13H20F2O and a molecular weight of 230.30 g/mol. Its IUPAC name is 4,6-difluoro-3-methyl-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzofuran.
| Compound Name | 4,6-difluoro-3-methyl-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzofuran |
|---|---|
| PubChem CID | 122532314 |
| Molecular Formula | C13H20F2O |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 4,6-difluoro-3-methyl-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzofuran |
| SMILES | CC1CCC2C3CCCC(F)C3OC2C1F |
| InChI | InChI=1S/C13H20F2O/c1-7-5-6-9-8-3-2-4-10(14)12(8)16-13(9)11(7)15/h7-13H,2-6H2,1H3 |
| InChIKey | NUHKQKIULGKKTA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |