About 2-methyl-1-[(2S,5R)-1-propan-2-yl-5-(trifluoromethyl)pyrrolidin-2-yl]propan-1-one
2-methyl-1-[(2S,5R)-1-propan-2-yl-5-(trifluoromethyl)pyrrolidin-2-yl]propan-1-one (PubChem CID 122532887) has the molecular formula C12H20F3NO
and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-methyl-1-[(2S,5R)-1-propan-2-yl-5-(trifluoromethyl)pyrrolidin-2-yl]propan-1-one.
Molecular Properties
| Compound Name | 2-methyl-1-[(2S,5R)-1-propan-2-yl-5-(trifluoromethyl)pyrrolidin-2-yl]propan-1-one |
| PubChem CID | 122532887 |
| Molecular Formula | C12H20F3NO |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-methyl-1-[(2S,5R)-1-propan-2-yl-5-(trifluoromethyl)pyrrolidin-2-yl]propan-1-one |
| SMILES | CC(C)C(=O)[C@@H]1CC[C@H](C(F)(F)F)N1C(C)C |
| InChI | InChI=1S/C12H20F3NO/c1-7(2)11(17)9-5-6-10(12(13,14)15)16(9)8(3)4/h7-10H,5-6H2,1-4H3/t9-,10+/m0/s1 |
| InChIKey | JIAUVKJCVRVWCZ-VHSXEESVSA-N |
| XLogP | 3.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-1-[(2S,5R)-1-propan-2-yl-5-(trifluoromethyl)pyrrolidin-2-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-[(2S,5R)-1-propan-2-yl-5-(trifluoromethyl)pyrrolidin-2-yl]propan-1-one?
The IUPAC name of 2-methyl-1-[(2S,5R)-1-propan-2-yl-5-(trifluoromethyl)pyrrolidin-2-yl]propan-1-one (CID 122532887) is 2-methyl-1-[(2S,5R)-1-propan-2-yl-5-(trifluoromethyl)pyrrolidin-2-yl]propan-1-one.
What is the SMILES notation for 2-methyl-1-[(2S,5R)-1-propan-2-yl-5-(trifluoromethyl)pyrrolidin-2-yl]propan-1-one?
The canonical SMILES for 2-methyl-1-[(2S,5R)-1-propan-2-yl-5-(trifluoromethyl)pyrrolidin-2-yl]propan-1-one is CC(C)C(=O)[C@@H]1CC[C@H](C(F)(F)F)N1C(C)C.
What is the InChIKey of 2-methyl-1-[(2S,5R)-1-propan-2-yl-5-(trifluoromethyl)pyrrolidin-2-yl]propan-1-one?
The InChIKey is JIAUVKJCVRVWCZ-VHSXEESVSA-N. The full InChI is InChI=1S/C12H20F3NO/c1-7(2)11(17)9-5-6-10(12(13,14)15)16(9)8(3)4/h7-10H,5-6H2,1-4H3/t9-,10+/m0/s1.
What are the key properties of 2-methyl-1-[(2S,5R)-1-propan-2-yl-5-(trifluoromethyl)pyrrolidin-2-yl]propan-1-one?
2-methyl-1-[(2S,5R)-1-propan-2-yl-5-(trifluoromethyl)pyrrolidin-2-yl]propan-1-one has a molecular weight of 251.29 g/mol, XLogP of 3.02, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-[(2S,5R)-1-propan-2-yl-5-(trifluoromethyl)pyrrolidin-2-yl]propan-1-one is sourced from PubChem (CID 122532887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).