C13H9F6N3 — CID 122533035
5-[4-ethyl-6-(trifluoromethyl)-2-pyridinyl]-2-(trifluoromethyl)pyrimidine (PubChem CID 122533035) has the molecular formula C13H9F6N3 and a molecular weight of 321.22 g/mol. Its IUPAC name is 5-[4-ethyl-6-(trifluoromethyl)-2-pyridinyl]-2-(trifluoromethyl)pyrimidine.
| Compound Name | 5-[4-ethyl-6-(trifluoromethyl)-2-pyridinyl]-2-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 122533035 |
| Molecular Formula | C13H9F6N3 |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 5-[4-ethyl-6-(trifluoromethyl)-2-pyridinyl]-2-(trifluoromethyl)pyrimidine |
| SMILES | CCc1cc(-c2cnc(C(F)(F)F)nc2)nc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H9F6N3/c1-2-7-3-9(22-10(4-7)12(14,15)16)8-5-20-11(21-6-8)13(17,18)19/h3-6H,2H2,1H3 |
| InChIKey | YPYPHLOIFSIMBZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |