About 3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-ynyl hexanoate
3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-ynyl hexanoate (PubChem CID 122533829) has the molecular formula C22H18F3NO7S
and a molecular weight of 497.45 g/mol. Its IUPAC name is 3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-ynyl hexanoate.
Molecular Properties
| Compound Name | 3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-ynyl hexanoate |
| PubChem CID | 122533829 |
| Molecular Formula | C22H18F3NO7S |
| Molecular Weight | 497.45 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | 3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-ynyl hexanoate |
| SMILES | CCCCCC(=O)OCC#Cc1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)C(F)(F)F)C2=O |
| InChI | InChI=1S/C22H18F3NO7S/c1-2-3-4-10-18(27)32-13-6-7-14-11-12-17-19-15(14)8-5-9-16(19)20(28)26(21(17)29)33-34(30,31)22(23,24)25/h5,8-9,11-12H,2-4,10,13H2,1H3 |
| InChIKey | SARSDYCEKIUKPQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 497.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-ynyl hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-ynyl hexanoate?
The IUPAC name of 3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-ynyl hexanoate (CID 122533829) is 3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-ynyl hexanoate.
What is the SMILES notation for 3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-ynyl hexanoate?
The canonical SMILES for 3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-ynyl hexanoate is CCCCCC(=O)OCC#Cc1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)C(F)(F)F)C2=O.
What is the InChIKey of 3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-ynyl hexanoate?
The InChIKey is SARSDYCEKIUKPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18F3NO7S/c1-2-3-4-10-18(27)32-13-6-7-14-11-12-17-19-15(14)8-5-9-16(19)20(28)26(21(17)29)33-34(30,31)22(23,24)25/h5,8-9,11-12H,2-4,10,13H2,1H3.
What are the key properties of 3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-ynyl hexanoate?
3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-ynyl hexanoate has a molecular weight of 497.45 g/mol, XLogP of 3.69, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-ynyl hexanoate is sourced from PubChem (CID 122533829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).