About 4-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]but-3-yn-2-yl butanoate
4-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]but-3-yn-2-yl butanoate (PubChem CID 122533833) has the molecular formula C21H16F3NO7S
and a molecular weight of 483.42 g/mol. Its IUPAC name is 4-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]but-3-yn-2-yl butanoate.
Molecular Properties
| Compound Name | 4-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]but-3-yn-2-yl butanoate |
| PubChem CID | 122533833 |
| Molecular Formula | C21H16F3NO7S |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | 4-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]but-3-yn-2-yl butanoate |
| SMILES | CCCC(=O)OC(C)C#Cc1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)C(F)(F)F)C2=O |
| InChI | InChI=1S/C21H16F3NO7S/c1-3-5-17(26)31-12(2)8-9-13-10-11-16-18-14(13)6-4-7-15(18)19(27)25(20(16)28)32-33(29,30)21(22,23)24/h4,6-7,10-12H,3,5H2,1-2H3 |
| InChIKey | OHNLYQHGUVPVPT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]but-3-yn-2-yl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]but-3-yn-2-yl butanoate?
The IUPAC name of 4-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]but-3-yn-2-yl butanoate (CID 122533833) is 4-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]but-3-yn-2-yl butanoate.
What is the SMILES notation for 4-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]but-3-yn-2-yl butanoate?
The canonical SMILES for 4-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]but-3-yn-2-yl butanoate is CCCC(=O)OC(C)C#Cc1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)C(F)(F)F)C2=O.
What is the InChIKey of 4-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]but-3-yn-2-yl butanoate?
The InChIKey is OHNLYQHGUVPVPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16F3NO7S/c1-3-5-17(26)31-12(2)8-9-13-10-11-16-18-14(13)6-4-7-15(18)19(27)25(20(16)28)32-33(29,30)21(22,23)24/h4,6-7,10-12H,3,5H2,1-2H3.
What are the key properties of 4-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]but-3-yn-2-yl butanoate?
4-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]but-3-yn-2-yl butanoate has a molecular weight of 483.42 g/mol, XLogP of 3.30, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]but-3-yn-2-yl butanoate is sourced from PubChem (CID 122533833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).