About 1-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]oct-1-yn-3-yl acetate
1-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]oct-1-yn-3-yl acetate (PubChem CID 122533843) has the molecular formula C23H20F3NO7S
and a molecular weight of 511.47 g/mol. Its IUPAC name is 1-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]oct-1-yn-3-yl acetate.
Molecular Properties
| Compound Name | 1-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]oct-1-yn-3-yl acetate |
| PubChem CID | 122533843 |
| Molecular Formula | C23H20F3NO7S |
| Molecular Weight | 511.47 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | 1-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]oct-1-yn-3-yl acetate |
| SMILES | CCCCCC(C#Cc1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)C(F)(F)F)C2=O)OC(C)=O |
| InChI | InChI=1S/C23H20F3NO7S/c1-3-4-5-7-16(33-14(2)28)12-10-15-11-13-19-20-17(15)8-6-9-18(20)21(29)27(22(19)30)34-35(31,32)23(24,25)26/h6,8-9,11,13,16H,3-5,7H2,1-2H3 |
| InChIKey | VKLIHYIKJHCHAU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 511.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]oct-1-yn-3-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]oct-1-yn-3-yl acetate?
The IUPAC name of 1-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]oct-1-yn-3-yl acetate (CID 122533843) is 1-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]oct-1-yn-3-yl acetate.
What is the SMILES notation for 1-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]oct-1-yn-3-yl acetate?
The canonical SMILES for 1-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]oct-1-yn-3-yl acetate is CCCCCC(C#Cc1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)C(F)(F)F)C2=O)OC(C)=O.
What is the InChIKey of 1-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]oct-1-yn-3-yl acetate?
The InChIKey is VKLIHYIKJHCHAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20F3NO7S/c1-3-4-5-7-16(33-14(2)28)12-10-15-11-13-19-20-17(15)8-6-9-18(20)21(29)27(22(19)30)34-35(31,32)23(24,25)26/h6,8-9,11,13,16H,3-5,7H2,1-2H3.
What are the key properties of 1-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]oct-1-yn-3-yl acetate?
1-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]oct-1-yn-3-yl acetate has a molecular weight of 511.47 g/mol, XLogP of 4.08, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]oct-1-yn-3-yl acetate is sourced from PubChem (CID 122533843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).