C9H14F5N — CID 122534021
4-methyl-1-(2,2,3,3,3-pentafluoropropyl)piperidine (PubChem CID 122534021) has the molecular formula C9H14F5N and a molecular weight of 231.21 g/mol. Its IUPAC name is 4-methyl-1-(2,2,3,3,3-pentafluoropropyl)piperidine.
| Compound Name | 4-methyl-1-(2,2,3,3,3-pentafluoropropyl)piperidine |
|---|---|
| PubChem CID | 122534021 |
| Molecular Formula | C9H14F5N |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 4-methyl-1-(2,2,3,3,3-pentafluoropropyl)piperidine |
| SMILES | CC1CCN(CC(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H14F5N/c1-7-2-4-15(5-3-7)6-8(10,11)9(12,13)14/h7H,2-6H2,1H3 |
| InChIKey | FTZAOWIGDNIWED-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|