About 1,10c-dihydropyren-4-ol
1,10c-dihydropyren-4-ol (PubChem CID 122534022) has the molecular formula C16H12O
and a molecular weight of 220.27 g/mol. Its IUPAC name is 1,10c-dihydropyren-4-ol.
Molecular Properties
| Compound Name | 1,10c-dihydropyren-4-ol |
| PubChem CID | 122534022 |
| Molecular Formula | C16H12O |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 1,10c-dihydropyren-4-ol |
| SMILES | OC1=C2C=CCC3=C2C2C(=CC=CC2=C1)C=C3 |
| InChI | InChI=1S/C16H12O/c17-14-9-12-5-1-3-10-7-8-11-4-2-6-13(14)16(11)15(10)12/h1-3,5-9,15,17H,4H2 |
| InChIKey | NHTHPKXCBSGNAH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,10c-dihydropyren-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,10c-dihydropyren-4-ol?
The IUPAC name of 1,10c-dihydropyren-4-ol (CID 122534022) is 1,10c-dihydropyren-4-ol.
What is the SMILES notation for 1,10c-dihydropyren-4-ol?
The canonical SMILES for 1,10c-dihydropyren-4-ol is OC1=C2C=CCC3=C2C2C(=CC=CC2=C1)C=C3.
What is the InChIKey of 1,10c-dihydropyren-4-ol?
The InChIKey is NHTHPKXCBSGNAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O/c17-14-9-12-5-1-3-10-7-8-11-4-2-6-13(14)16(11)15(10)12/h1-3,5-9,15,17H,4H2.
What are the key properties of 1,10c-dihydropyren-4-ol?
1,10c-dihydropyren-4-ol has a molecular weight of 220.27 g/mol, XLogP of 3.68, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,10c-dihydropyren-4-ol is sourced from PubChem (CID 122534022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).