About 6-amino-3-propan-2-yl-1,6-dihydropyrimidine-2-thione
6-amino-3-propan-2-yl-1,6-dihydropyrimidine-2-thione (PubChem CID 122534210) has the molecular formula C7H13N3S
and a molecular weight of 171.27 g/mol. Its IUPAC name is 6-amino-3-propan-2-yl-1,6-dihydropyrimidine-2-thione.
Molecular Properties
| Compound Name | 6-amino-3-propan-2-yl-1,6-dihydropyrimidine-2-thione |
| PubChem CID | 122534210 |
| Molecular Formula | C7H13N3S |
| Molecular Weight | 171.27 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 6-amino-3-propan-2-yl-1,6-dihydropyrimidine-2-thione |
| SMILES | CC(C)N1C=CC(N)NC1=S |
| InChI | InChI=1S/C7H13N3S/c1-5(2)10-4-3-6(8)9-7(10)11/h3-6H,8H2,1-2H3,(H,9,11) |
| InChIKey | VZJCMSRVZVBHBC-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-3-propan-2-yl-1,6-dihydropyrimidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3-propan-2-yl-1,6-dihydropyrimidine-2-thione?
The IUPAC name of 6-amino-3-propan-2-yl-1,6-dihydropyrimidine-2-thione (CID 122534210) is 6-amino-3-propan-2-yl-1,6-dihydropyrimidine-2-thione.
What is the SMILES notation for 6-amino-3-propan-2-yl-1,6-dihydropyrimidine-2-thione?
The canonical SMILES for 6-amino-3-propan-2-yl-1,6-dihydropyrimidine-2-thione is CC(C)N1C=CC(N)NC1=S.
What is the InChIKey of 6-amino-3-propan-2-yl-1,6-dihydropyrimidine-2-thione?
The InChIKey is VZJCMSRVZVBHBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3S/c1-5(2)10-4-3-6(8)9-7(10)11/h3-6H,8H2,1-2H3,(H,9,11).
What are the key properties of 6-amino-3-propan-2-yl-1,6-dihydropyrimidine-2-thione?
6-amino-3-propan-2-yl-1,6-dihydropyrimidine-2-thione has a molecular weight of 171.27 g/mol, XLogP of 0.38, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3-propan-2-yl-1,6-dihydropyrimidine-2-thione is sourced from PubChem (CID 122534210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).