About 6-amino-3-methyl-1,6-dihydropyrimidine-2-thione
6-amino-3-methyl-1,6-dihydropyrimidine-2-thione (PubChem CID 122534221) has the molecular formula C5H9N3S
and a molecular weight of 143.21 g/mol. Its IUPAC name is 6-amino-3-methyl-1,6-dihydropyrimidine-2-thione.
Molecular Properties
| Compound Name | 6-amino-3-methyl-1,6-dihydropyrimidine-2-thione |
| PubChem CID | 122534221 |
| Molecular Formula | C5H9N3S |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 6-amino-3-methyl-1,6-dihydropyrimidine-2-thione |
| SMILES | CN1C=CC(N)NC1=S |
| InChI | InChI=1S/C5H9N3S/c1-8-3-2-4(6)7-5(8)9/h2-4H,6H2,1H3,(H,7,9) |
| InChIKey | FTEWJBZHZPLDFM-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-3-methyl-1,6-dihydropyrimidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3-methyl-1,6-dihydropyrimidine-2-thione?
The IUPAC name of 6-amino-3-methyl-1,6-dihydropyrimidine-2-thione (CID 122534221) is 6-amino-3-methyl-1,6-dihydropyrimidine-2-thione.
What is the SMILES notation for 6-amino-3-methyl-1,6-dihydropyrimidine-2-thione?
The canonical SMILES for 6-amino-3-methyl-1,6-dihydropyrimidine-2-thione is CN1C=CC(N)NC1=S.
What is the InChIKey of 6-amino-3-methyl-1,6-dihydropyrimidine-2-thione?
The InChIKey is FTEWJBZHZPLDFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3S/c1-8-3-2-4(6)7-5(8)9/h2-4H,6H2,1H3,(H,7,9).
What are the key properties of 6-amino-3-methyl-1,6-dihydropyrimidine-2-thione?
6-amino-3-methyl-1,6-dihydropyrimidine-2-thione has a molecular weight of 143.21 g/mol, XLogP of -0.40, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3-methyl-1,6-dihydropyrimidine-2-thione is sourced from PubChem (CID 122534221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).